Home
>
Materials Science>Organic monomer of COF> 4,4'-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dianiline
For research use only. Not for therapeutic Use.
4,4′-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dianiline (Cat.No:L003643) is a pivotal compound in materials science. Its unique structure, incorporating a benzo[c][1,2,5]thiadiazole core, imparts desirable electronic properties. This makes it a vital building block for the synthesis of semiconducting polymers and optoelectronic devices. Its role in advancing technologies like organic solar cells and field-effect transistors underscores its significance in the development of cutting-edge materials for various applications.
CAS Number | 1203707-77-0 |
Molecular Formula | C18H14N4S |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline |
InChI | InChI=1S/C18H14N4S/c19-13-5-1-11(2-6-13)15-9-10-16(18-17(15)21-23-22-18)12-3-7-14(20)8-4-12/h1-10H,19-20H2 |
InChIKey | JVODNHZESHSUJN-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=C(C3=NSN=C23)C4=CC=C(C=C4)N)N |