Home
>
Materials Science>Organic monomer of COF> 4,4'-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dibenzaldehyde
For research use only. Not for therapeutic Use.
4,4′-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dibenzaldehyde (Cat.No:L003981) is a crucial compound in materials science. Its unique structure, incorporating a benzo[c][1,2,5]thiadiazole core, imparts specialized properties. This compound is utilized in the synthesis of advanced materials, particularly in the field of optoelectronics.
CAS Number | 914651-17-5 |
Molecular Formula | C20H12N2O2S |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-formylphenyl)-2,1,3-benzothiadiazol-7-yl]benzaldehyde |
InChI | InChI=1S/C20H12N2O2S/c23-11-13-1-5-15(6-2-13)17-9-10-18(20-19(17)21-25-22-20)16-7-3-14(12-24)4-8-16/h1-12H |
InChIKey | JDMIEZMXBAUTSW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C3=NSN=C23)C4=CC=C(C=C4)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |