Home
>
Materials Science>Organic ligands for MOF materials> 4,4'-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dibenzoic acid
For research use only. Not for therapeutic Use.
4,4′-(Benzo[c][1,2,5]thiadiazole-4,7-diyl)dibenzoic acid (Cat.No:L003961) is a crucial compound in materials science. Its unique benzo[c][1,2,5]thiadiazole core imparts specialized properties, making it valuable in the synthesis of advanced materials for optoelectronics and semiconductors. This compound’s versatile reactivity and distinctive structure make it a key building block in the development of innovative products, underscoring its significance in contemporary chemical research.
CAS Number | 1581774-76-6 |
Molecular Formula | C20H12N2O4S |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-carboxyphenyl)-2,1,3-benzothiadiazol-7-yl]benzoic acid |
InChI | InChI=1S/C20H12N2O4S/c23-19(24)13-5-1-11(2-6-13)15-9-10-16(18-17(15)21-27-22-18)12-3-7-14(8-4-12)20(25)26/h1-10H,(H,23,24)(H,25,26) |
InChIKey | VGZMJLKGOXHSDI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=C(C3=NSN=C23)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |