For research use only. Not for therapeutic Use.
4,4′-Bis(dimethylamino)thiobenzophenone(Cat No.:M047604), often abbreviated as Michler’s ketone, is a synthetic organic compound featuring a thiobenzophenone core with two dimethylamino groups attached at the 4 and 4′ positions. This structure grants it strong electron-donating properties and notable photoreactivity. Michler’s ketone is primarily utilized as a photoinitiator in the polymerization of resins and as a dye precursor in the production of various pigments and inks. Its ability to absorb light and subsequently generate reactive species makes it valuable in UV-curing applications, especially in the printing and coatings industries.
CAS Number | 1226-46-6 |
Molecular Formula | C17H20N2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis[4-(dimethylamino)phenyl]methanethione |
InChI | InChI=1S/C17H20N2S/c1-18(2)15-9-5-13(6-10-15)17(20)14-7-11-16(12-8-14)19(3)4/h5-12H,1-4H3 |
InChIKey | KFUJUTFTRXYQMG-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC=C(C=C1)C(=S)C2=CC=C(C=C2)N(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |