For research use only. Not for therapeutic Use.
4,4’-Bis(maleoylamino)azobenzene(Cat No.:R040278)is an organic compound featuring two maleoylamino groups attached to an azobenzene core. This compound is significant in material science due to its photoresponsive properties, where the azobenzene unit undergoes reversible trans-cis isomerization upon exposure to light. It is utilized in the development of smart materials, such as photo-switchable polymers and molecular switches. Additionally, its maleoylamino groups provide reactive sites for further chemical modifications, enhancing its versatility. Applications include optical data storage, light-controlled drug delivery systems, and the creation of advanced functional materials in nanotechnology.
CAS Number | 77280-58-1 |
Synonyms | 1,1’-(1,2-Diazenediyldi-4,1-phenylene)bis-1H-pyrrole-2,5-dione; N,N’-(azodi-p-phenylene)dimaleimide; |
Molecular Formula | C20H12N4O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione |
InChI | InChI=1S/C20H12N4O4/c25-17-9-10-18(26)23(17)15-5-1-13(2-6-15)21-22-14-3-7-16(8-4-14)24-19(27)11-12-20(24)28/h1-12H |
InChIKey | IEMFDYPKHKLPGO-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)N3C(=O)C=CC3=O)N4C(=O)C=CC4=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |