For research use only. Not for therapeutic Use.
4,4′-(Buta-1,3-diyne-1,4-diyl)dibenzoic acid (Cat.No:L003931) is a crucial compound in organic synthesis. Its unique structure, featuring a butadiyne linkage between two benzoic acid units, imparts specialized reactivity and properties. This compound serves as a valuable building block in the creation of specialized materials with applications in pharmaceuticals and materials science.
CAS Number | 116075-75-3 |
Molecular Formula | C18H10O4 |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-carboxyphenyl)buta-1,3-diynyl]benzoic acid |
InChI | InChI=1S/C18H10O4/c19-17(20)15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(12-8-14)18(21)22/h5-12H,(H,19,20)(H,21,22) |
InChIKey | YROTZTMCXKTYMW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#CC#CC2=CC=C(C=C2)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |