For research use only. Not for therapeutic Use.
4,4′-Diamino-2,2′-difluorobiphenyl(Cat No.:L033188)is an organic compound with the formula C12H8F2N2, featuring a biphenyl structure substituted with two fluorine atoms and two amino groups. This compound is valued in chemical synthesis and material science for its ability to form robust polymers and co-polymers. Its diamino groups facilitate reactions with various electrophiles, while the fluorine substituents enhance the thermal and chemical stability of the resulting materials. Common applications include the production of advanced plastics, electronics, and high-performance coatings, where stability under harsh conditions is crucial.
CAS Number | 316-64-3 |
Molecular Formula | C12H10F2N2 |
Purity | ≥95% |
IUPAC Name | 4-(4-amino-2-fluorophenyl)-3-fluoroaniline |
InChI | InChI=1S/C12H10F2N2/c13-11-5-7(15)1-3-9(11)10-4-2-8(16)6-12(10)14/h1-6H,15-16H2 |
InChIKey | LSJAPRRUOIMQSN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N)F)C2=C(C=C(C=C2)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |