For research use only. Not for therapeutic Use.
4,4′-Difluoro-2,2′-bipyridine(CAT: L015744) is a high-purity compound widely used in pharmaceutical, material science, and coordination chemistry research. This bipyridine derivative, featuring fluorine atoms at the 4 and 4′ positions, serves as a versatile ligand in the synthesis of metal complexes and catalysts. Its unique electronic properties make it valuable in applications such as organic electronics, photophysics, and the development of novel coordination compounds. With excellent stability and reactivity, 4,4′-Difluoro-2,2′-bipyridine provides researchers with a reliable tool for exploring innovative molecular designs in synthetic chemistry and materials science.
CAS Number | 1189458-67-0 |
Molecular Formula | C10H6F2N2 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-2-(4-fluoropyridin-2-yl)pyridine |
InChI | InChI=1S/C10H6F2N2/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H |
InChIKey | MKQUGHDXOCXHMY-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=C1F)C2=NC=CC(=C2)F |