For research use only. Not for therapeutic Use.
4,4′-Difluorobenzil(CAT: L014515) is a high-purity aromatic compound featuring two fluorine-substituted benzene rings connected by a diketone bridge. This versatile molecule is widely utilized in pharmaceutical, material science, and chemical research as a key intermediate in the synthesis of complex organic compounds, including bioactive molecules and advanced materials. Its unique structure, combining fluorine atoms and a diketone functionality, makes it particularly valuable for exploring reaction mechanisms and developing innovative materials for optoelectronic and functional applications. With consistent quality and excellent stability, 4,4′-Difluorobenzil supports cutting-edge research in organic synthesis and material development.
CAS Number | 579-39-5 |
Molecular Formula | C14H8F2O2 |
Purity | ≥95% |
IUPAC Name | 1,2-bis(4-fluorophenyl)ethane-1,2-dione |
InChI | InChI=1S/C14H8F2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
InChIKey | BRKULQOUSCHDGS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |