For research use only. Not for therapeutic Use.
4,4-Difluorocyclohexane-1-thiol is a chemical compound featuring a cyclohexane ring with a fluorine atom attached to each of the carbon atoms at the 4th position, along with a thiol (-SH) group at the 1st position. This molecule is of interest in organic chemistry due to its unique structure and potential reactivity. Thiol-containing compounds like 4,4-Difluorocyclohexane-1-thiol have applications in chemical synthesis, particularly in the preparation of sulfur-containing organic molecules and materials. Research is ongoing to explore its properties and potential uses in various synthetic and materials chemistry applications.
CAS Number | 1543102-18-6 |
Molecular Formula | C6H10F2S |
Purity | ≥95% |
IUPAC Name | 4,4-difluorocyclohexane-1-thiol |
InChI | InChI=1S/C6H10F2S/c7-6(8)3-1-5(9)2-4-6/h5,9H,1-4H2 |
InChIKey | TUDPCVKWDUEBPO-UHFFFAOYSA-N |
SMILES | C1CC(CCC1S)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |