For research use only. Not for therapeutic Use.
4,4′-Di(furan-2-yl)-6,6′-dimethyl-2,2′-bipyridine is a bipyridine derivative featuring two furan rings and two methyl groups on the 2,2′-positions. This compound is of interest in organic synthesis and material science due to its potential applications in organic electronics and photovoltaics. The presence of furan rings enhances its electron-donating properties, making it suitable for forming coordination complexes with metal ions. Its unique structure allows for versatile modifications, contributing to the development of novel functional materials and catalysts in chemical research.
CAS Number | 144342-48-3 |
Molecular Formula | C20H16N2O2 |
Purity | ≥95% |
IUPAC Name | 4-(furan-2-yl)-2-[4-(furan-2-yl)-6-methylpyridin-2-yl]-6-methylpyridine |
InChI | InChI=1S/C20H16N2O2/c1-13-9-15(19-5-3-7-23-19)11-17(21-13)18-12-16(10-14(2)22-18)20-6-4-8-24-20/h3-12H,1-2H3 |
InChIKey | RIGMCTLVQLAHJC-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=N1)C2=NC(=CC(=C2)C3=CC=CO3)C)C4=CC=CO4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |