For research use only. Not for therapeutic Use.
4,4′-Dimethoxybenzhydrol(CAT: L014507) is a high-purity organic compound featuring a benzhydrol core with methoxy groups substituted at the 4-positions on both aromatic rings. This versatile molecule serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it suitable for applications in designing bioactive molecules, such as enzyme inhibitors and advanced materials. 4,4′-Dimethoxybenzhydrol is widely used in medicinal chemistry, material science, and organic synthesis, offering excellent stability and reliability for innovative research and fine chemical production.
| Catalog Number | L014507 |
| CAS Number | 728-87-0 |
| Molecular Formula | C15H16O3 |
| Purity | ≥95% |
| IUPAC Name | bis(4-methoxyphenyl)methanol |
| InChI | InChI=1S/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
| InChIKey | ZODAOVNETBTTJX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)O |
