For research use only. Not for therapeutic Use.
4,4′-Dimethoxychalcone(CAT: M147787) is an organic compound belonging to the chalcone family. Its mode of action involves serving as a chalcone derivative with two methoxy groups (-OCH3) attached to its phenyl rings. This compound exhibits interesting biological and pharmacological properties, including antioxidant and anti-inflammatory activities. It is of interest in medicinal research for its potential therapeutic applications. Additionally, 4,4′-Dimethoxychalcone finds use as a building block in organic synthesis, serving as a starting material for the preparation of various bioactive molecules and pharmaceutical candidates.
| Catalog Number | M147787 |
| CAS Number | 2373-89-9 |
| Molecular Formula | C17H16O3 |
| Purity | ≥95% |
| Target | Autophagy |
| IUPAC Name | (E)-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3/b12-5+ |
| InChIKey | HDXVSZWKIHQDES-LFYBBSHMSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)C2=CC=C(C=C2)OC |
