For research use only. Not for therapeutic Use.
4,4-Dimethylimidazolidin-2-one(Cat No.:L010397)is a cyclic urea compound known for its stability and versatility in organic synthesis. It serves as a valuable intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. The dimethyl groups on the imidazolidinone ring provide steric hindrance, enhancing the compound’s reactivity and selectivity in various chemical reactions. This compound is also used as a solvent or reagent in catalytic processes and polymer chemistry. Its unique structure makes it an important building block in developing new materials and bioactive molecules.
CAS Number | 24572-33-6 |
Molecular Formula | C5H10N2O |
Purity | ≥95% |
IUPAC Name | 4,4-dimethylimidazolidin-2-one |
InChI | InChI=1S/C5H10N2O/c1-5(2)3-6-4(8)7-5/h3H2,1-2H3,(H2,6,7,8) |
InChIKey | IRLLLHYGMMQKFU-UHFFFAOYSA-N |
SMILES | CC1(CNC(=O)N1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |