For research use only. Not for therapeutic Use.
4,4′-Dipyridyl, also known as 4,4′-bipyridine, is an organic compound consisting of two pyridine rings connected by a single bond at the 4-position. This bipyridine structure imparts unique chemical properties, making it valuable in coordination chemistry and organic synthesis. The nitrogen atoms in the pyridine rings can act as electron-rich sites, facilitating coordination with metal ions and forming chelates. 4,4′-Dipyridyl is utilized in the synthesis of ligands, catalysts, and in the development of materials for various applications, including sensors and electronics.
| Catalog Number | R061360 |
| CAS Number | 553-26-4 |
| Synonyms | 4,4’-Bipyridine; 4,4’-Bipyridyl; 4,4’-Dipyridine; 4-(4-Pyridyl)pyridine; IK 12; NSC 404423; SERS 420; γ,γ’-Bipyridyl; γ,γ’-Dipyridyl |
| Molecular Formula | C10H8N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-pyridin-4-ylpyridine |
| InChI | InChI=1S/C10H8N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8H |
| InChIKey | MWVTWFVJZLCBMC-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC=NC=C2 |
