For research use only. Not for therapeutic Use.
4,4′-(Hexafluoroisopropylidene) phthalic anhydride(Cat No.:M069325) is a compound used in various chemical processes, particularly in the production of high-performance polymers and resins. Its molecular structure includes two phthalic anhydride groups connected by a hexafluoroisopropylidene bridge. This unique configuration imparts exceptional thermal stability and chemical resistance to materials incorporating it. Due to these properties, it finds applications in industries ranging from aerospace to electronics.
CAS Number | 1107-00-2 |
Molecular Formula | C19H6F6O6 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
InChI | InChI=1S/C19H6F6O6/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27/h1-6H |
InChIKey | QHHKLPCQTTWFSS-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C(C3=CC4=C(C=C3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)C(=O)OC2=O |