For research use only. Not for therapeutic Use.
4,4′-(Hexafluoroisopropylidene) phthalic anhydride（Cat No.:M069325） is a compound used in various chemical processes, particularly in the production of high-performance polymers and resins. Its molecular structure includes two phthalic anhydride groups connected by a hexafluoroisopropylidene bridge. This unique configuration imparts exceptional thermal stability and chemical resistance to materials incorporating it. Due to these properties, it finds applications in industries ranging from aerospace to electronics.
| CAS Number | 1107-00-2 |
| Molecular Formula | C19H6F6O6 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
| InChI | InChI=1S/C19H6F6O6/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27/h1-6H |
| InChIKey | QHHKLPCQTTWFSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(C3=CC4=C(C=C3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)C(=O)OC2=O |
