For research use only. Not for therapeutic Use.
4,4’-Iminodiphenol is an organic compound featuring two phenol groups connected by an imine linkage. This bifunctional molecule is used in polymer chemistry and materials science, serving as a building block for synthesizing advanced polymers and resins. Its structure allows for diverse chemical modifications, making it valuable in developing new materials with specialized properties.
| CAS Number | 1752-24-5 |
| Synonyms | 4,4’-Iminobis[phenol]; 4,4’-Dihydroxydiphenylamine; 4,4’-Iminobisphenol; 4-(4-Hydroxyanilino)phenol; Bis(4-hydroxyphenyl)amine; Bis(p-hydroxyphenyl)amine; Leucoindophenol; N-(4’-Hydroxyphenyl)-p-aminophenol; |
| Molecular Formula | C12H11NO2 |
| Purity | ≥95% |
| Target | Estrogen Receptor/ERR |
| Storage | -20°C |
| IUPAC Name | 4-(4-hydroxyanilino)phenol |
| InChI | InChI=1S/C12H11NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,13-15H |
| InChIKey | YRUPBAWWCPVHFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
