For research use only. Not for therapeutic Use.
4,4’-Iminodiphenol is an organic compound featuring two phenol groups connected by an imine linkage. This bifunctional molecule is used in polymer chemistry and materials science, serving as a building block for synthesizing advanced polymers and resins. Its structure allows for diverse chemical modifications, making it valuable in developing new materials with specialized properties.
Catalog Number | R036559 |
CAS Number | 1752-24-5 |
Synonyms | 4,4’-Iminobis[phenol]; 4,4’-Dihydroxydiphenylamine; 4,4’-Iminobisphenol; 4-(4-Hydroxyanilino)phenol; Bis(4-hydroxyphenyl)amine; Bis(p-hydroxyphenyl)amine; Leucoindophenol; N-(4’-Hydroxyphenyl)-p-aminophenol; |
Molecular Formula | C12H11NO2 |
Purity | ≥95% |
Target | Estrogen Receptor/ERR |
Storage | -20°C |
IUPAC Name | 4-(4-hydroxyanilino)phenol |
InChI | InChI=1S/C12H11NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,13-15H |
InChIKey | YRUPBAWWCPVHFT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)O)O |