For research use only. Not for therapeutic Use.
4,4′-Isopropylidene-bis(2-t-butylphenol)(Cat No.:M016762) is a chemical compound featuring two 2-t-butylphenol groups linked through a central isopropylidene bridge. This molecular structure imparts significant antioxidant properties, making it widely utilized as a stabilizer in plastics and rubber manufacturing to prevent oxidation and degradation of materials. The bulky t-butyl groups enhance their effectiveness by providing steric hindrance that protects the phenolic hydroxyl groups, crucial for scavenging free radicals. Such a configuration makes it highly effective in environments exposed to heat and oxygen, thereby extending the life and maintaining the integrity of polymer-based products.
Catalog Number | M016762 |
CAS Number | 79-96-9 |
Synonyms | 4,4′-ISOPROPYLIDENEBIS(2-T-BUTYLPHENOL);(2,2’-di-tert-butyl-4,4’-isopropylene)di-pheno;4,4’-(1-methylethylidene)bis(2-(1,1-dimethylethyl)-pheno;4,4’-(1-methylethylidene)bis[2-(1,1-dimethylethyl)-pheno;4,4’-isopropylidenebis(2-tert-butyl-pheno;4,4/’- |
Molecular Formula | C23H32O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxyphenyl)propan-2-yl]phenol |
InChI | InChI=1S/C23H32O2/c1-21(2,3)17-13-15(9-11-19(17)24)23(7,8)16-10-12-20(25)18(14-16)22(4,5)6/h9-14,24-25H,1-8H3 |
InChIKey | ZDRSNHRWLQQICP-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=C(C=CC(=C1)C(C)(C)C2=CC(=C(C=C2)O)C(C)(C)C)O |