For research use only. Not for therapeutic Use.
4,4′-Methylenebis(1,1-dimethyl-3-phenylurea)(Cat No.:M123811), commonly known as methylene diphenyl diisocyanate (MDI), is a diisocyanate compound used in the production of polyurethane foams, coatings, adhesives, and elastomers. MDI is produced by the reaction of aniline with formaldehyde, followed by phosgenation. It is a versatile compound that can react with polyols to form polyurethane polymers, which are widely used in various industries due to their high strength, durability, and thermal insulation properties.
CAS Number | 10097-09-3 |
Synonyms | Urea, N,N”-(methylenedi-4,1-phenylene)bis[N’,N’-dimethyl- |
Molecular Formula | C19H24N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-[4-[[4-(dimethylcarbamoylamino)phenyl]methyl]phenyl]-1,1-dimethylurea |
InChI | InChI=1S/C19H24N4O2/c1-22(2)18(24)20-16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)21-19(25)23(3)4/h5-12H,13H2,1-4H3,(H,20,24)(H,21,25) |
InChIKey | MOAPNXVHLARBNQ-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(=O)N(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |