For research use only. Not for therapeutic Use.
4,4′,4”-(1,3,5-Triazine-2,4,6-triyl)triphenol(CAT: L000079) is a significant compound in the fields of organic chemistry and material science. This chemical structure comprises a triazine core with three phenolic groups. It is widely used as a key building block in the synthesis of organic compounds, particularly in the development of advanced materials and specialty polymers. Its unique structure allows for precise control of molecular properties, making it valuable in the design of materials with tailored characteristics.
CAS Number | 7753-13-1 |
Molecular Formula | C21H15N3O3 |
Purity | ≥95% |
IUPAC Name | 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
InChI | InChI=1S/C21H15N3O3/c25-16-7-1-13(2-8-16)19-22-20(14-3-9-17(26)10-4-14)24-21(23-19)15-5-11-18(27)12-6-15/h1-12,25-27H |
InChIKey | GPSBTCCYBACYRE-UHFFFAOYSA-N |