For research use only. Not for therapeutic Use.
4,4′,4”-(2,4,6-Trimethylbenzene-1,3,5-triyl)tripyridine (Cat.No:L004117) is a significant compound in materials science. Its unique structure, featuring a tripyridine framework linked by a trimethylbenzene core, imparts specialized properties. This compound serves as a key component in the synthesis of specialized materials, particularly in the field of organic electronics.
CAS Number | 2027486-17-3 |
Molecular Formula | C24H21N3 |
Purity | ≥95% |
IUPAC Name | 4-(2,4,6-trimethyl-3,5-dipyridin-4-ylphenyl)pyridine |
InChI | InChI=1S/C24H21N3/c1-16-22(19-4-10-25-11-5-19)17(2)24(21-8-14-27-15-9-21)18(3)23(16)20-6-12-26-13-7-20/h4-15H,1-3H3 |
InChIKey | VPXMOBBDEOKAOS-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1C2=CC=NC=C2)C)C3=CC=NC=C3)C)C4=CC=NC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |