For research use only. Not for therapeutic Use.
4,4′,4”-(Pyridine-2,4,6-triyl)trianiline (Cat.No:L003527) is a crucial compound in materials science. Its distinctive pyridine core and trianiline structure confer special electronic properties, making it valuable in organic electronics and optoelectronics. This compound is utilized in the development of light-emitting diodes (LEDs) and organic semiconductors, highlighting its significance in modern technology and its contribution to the advancement of electronic devices.
| Catalog Number | L003527 |
| CAS Number | 83266-97-1 |
| Molecular Formula | C23H20N4 |
| Purity | ≥95% |
| IUPAC Name | 4-[2,6-bis(4-aminophenyl)pyridin-4-yl]aniline |
| InChI | InChI=1S/C23H20N4/c24-19-7-1-15(2-8-19)18-13-22(16-3-9-20(25)10-4-16)27-23(14-18)17-5-11-21(26)12-6-17/h1-14H,24-26H2 |
| InChIKey | NOESMJBODNBEAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
