For research use only. Not for therapeutic Use.
4,4,4-Trifluoro-3-oxo-2-(phenylhydrazine)butyric acid ethyl ester(Cat No.:M047002) is a specialized chemical compound featuring a trifluoromethyl group, a phenylhydrazine moiety, and an ester linkage. The presence of the trifluoromethyl group increases its chemical and thermal stability, while the phenylhydrazine group contributes to its reactivity, particularly in forming hydrazone linkages. This compound is used primarily in organic synthesis, serving as a versatile intermediate for the preparation of various organic molecules. Its structure allows it to participate in reactions that form complex molecular architectures, making it valuable in pharmaceutical and agrochemical research.
CAS Number | 1494-98-0 |
Molecular Formula | C12H11F3N2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl (Z)-4,4,4-trifluoro-3-hydroxy-2-phenyldiazenylbut-2-enoate |
InChI | InChI=1S/C12H11F3N2O3/c1-2-20-11(19)9(10(18)12(13,14)15)17-16-8-6-4-3-5-7-8/h3-7,18H,2H2,1H3/b10-9-,17-16? |
InChIKey | VIGVOIMFLWUOHS-VRMCWJJMSA-N |
SMILES | CCOC(=O)C(=C(C(F)(F)F)O)N=NC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |