For research use only. Not for therapeutic Use.
4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid(Cat No.:M121273)is a high-purity fluorinated compound widely utilized in pharmaceutical and chemical research. Featuring a trifluoromethyl group and three additional fluorine atoms, this crotonic acid derivative is essential for synthesizing fluorinated organic molecules, particularly in the development of new drugs and agrochemicals. Its unique structure enhances the stability and bioavailability of target molecules, making it a valuable building block in medicinal chemistry. 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ensures consistent and reliable performance in complex synthetic processes.
CAS Number | 1763-28-6 |
Molecular Formula | C5H2F6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoic acid |
InChI | InChI=1S/C5H2F6O2/c6-4(7,8)2(1-3(12)13)5(9,10)11/h1H,(H,12,13) |
InChIKey | ZSBJCNVMTCMOBW-UHFFFAOYSA-N |
SMILES | C(=C(C(F)(F)F)C(F)(F)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |