For research use only. Not for therapeutic Use.
4,4,5,5-Tetramethyl-2-(propa-1,2-dien-1-yl)-1,3,2-dioxaborolane(Cat No.:L006728), is a boron-containing compound important in organic synthesis. It features a dioxaborolane ring substituted with a propa-1,2-dien-1-yl group and four methyl groups. This compound is valuable in cross-coupling reactions, specifically Suzuki-Miyaura coupling, where it acts as a key reagent for creating carbon-carbon bonds. Its unique structure and reactivity enable the incorporation of diverse functionalities into complex organic molecules, making it essential in medicinal chemistry and material science.
Catalog Number | L006728 |
CAS Number | 865350-17-0 |
Molecular Formula | C9H15BO2 |
Purity | ≥95% |
Storage | 2-8°C |
InChI | InChI=1S/C9H15BO2/c1-6-7-10-11-8(2,3)9(4,5)12-10/h7H,1H2,2-5H3 |
InChIKey | CJAOMXUZZONOSD-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C=C=C |