For research use only. Not for therapeutic Use.
4,5-Dibromo-1H-indazole (Cat.No:L003560) is a pivotal chemical compound with diverse applications in pharmaceutical research. Its unique indazole scaffold imparts valuable pharmacological properties, rendering it a significant building block in drug development. This compound serves as a crucial intermediate in the synthesis of various pharmaceutical agents, emphasizing its importance in medicinal chemistry.
Catalog Number | L003560 |
CAS Number | 1351668-28-4 |
Molecular Formula | C7H4Br2N2 |
Purity | ≥95% |
IUPAC Name | 4,5-dibromo-1H-indazole |
InChI | InChI=1S/C7H4Br2N2/c8-5-1-2-6-4(7(5)9)3-10-11-6/h1-3H,(H,10,11) |
InChIKey | BIXHHZVOQFJKSH-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1NN=C2)Br)Br |