For research use only. Not for therapeutic Use.
4,5-Dichloro-1,2,3-dithiazol-1-ium chloride (Cat No.:M010789) is a chemical compound. It is a dithiazole derivative featuring two chlorine atoms substituted at positions 4 and 5 of the dithiazole ring and a chloride anion. This compound is utilized in organic synthesis as a reagent for the preparation of various organic molecules. Its unique dithiazole structure imparts specific reactivity, making it valuable in creating diverse compounds. 4,5-Dichloro-1,2,3-dithiazol-1-ium chloride plays a role as an intermediate in the synthesis of functional compounds for applications in chemical research and pharmaceutical industries.
CAS Number | 75318-43-3 |
Synonyms | 4,5-Dichloro-1,2,3-dithiazol-1-ium chloride;Appel salt;4,5-Dichloro-1,2,3-dithiazolium chloride;D14145;4,5-DICHLORO-1,2,3-DITHIAZOLIUM;4,5-Dichloro-1,2,3-dithiazol-2-ylium chloride |
Molecular Formula | C2Cl3NS2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4,5-dichlorodithiazol-1-ium;chloride |
InChI | InChI=1S/C2Cl2NS2.ClH/c3-1-2(4)6-7-5-1;/h;1H/q+1;/p-1 |
InChIKey | NIZMCFUMSHISLW-UHFFFAOYSA-M |
SMILES | C1(=NS[S+]=C1Cl)Cl.[Cl-] |