For research use only. Not for therapeutic Use.
4,5-Dichloro-2-iodoaniline(Cat No.:L032046)is a halogenated aromatic amine characterized by chlorine and iodine substituents on the benzene ring, paired with an amino group. This compound is extensively used in organic synthesis, particularly in the creation of dyes, pharmaceuticals, and agrochemicals. Its halogen atoms make it highly reactive and suitable for coupling reactions used in the synthesis of complex organic molecules. The presence of both amino and halogen groups allows for versatile chemical modifications, making it a crucial intermediate in the development of novel compounds with specific biological activities.
CAS Number | 220185-63-7 |
Molecular Formula | C6H4Cl2IN |
Purity | ≥95% |
IUPAC Name | 4,5-dichloro-2-iodoaniline |
InChI | InChI=1S/C6H4Cl2IN/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
InChIKey | PLPUEJCYMXSRKW-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)Cl)I)N |