For research use only. Not for therapeutic Use.
4,5-Dichloro-2-(methylsulfanyl)pyrimidine(CAT: L011814) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. This pyrimidine derivative features two chlorine atoms and a methylsulfanyl group, providing a reactive scaffold for diverse synthetic applications. It serves as a valuable intermediate in the development of bioactive molecules, including pharmaceuticals and agrochemicals. Its unique structure enables participation in substitution and coupling reactions, facilitating the creation of advanced materials and drug candidates. With consistent quality and reactivity, 4,5-Dichloro-2-(methylsulfanyl)pyrimidine is an essential reagent for innovative research and precision chemical synthesis.
CAS Number | 99469-85-9 |
Molecular Formula | C5H4Cl2N2S |
Purity | ≥95% |
IUPAC Name | 4,5-dichloro-2-methylsulfanylpyrimidine |
InChI | InChI=1S/C5H4Cl2N2S/c1-10-5-8-2-3(6)4(7)9-5/h2H,1H3 |
InChIKey | JATIYCWFOYRIEM-UHFFFAOYSA-N |
SMILES | CSC1=NC=C(C(=N1)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |