For research use only. Not for therapeutic Use.
4,5-Dichloro-2,6-dimethylpyrimidine(CAT: L030820) is a high-purity heterocyclic compound featuring a pyrimidine core with two chlorine atoms at positions 4 and 5 and methyl groups at positions 2 and 6. This versatile molecule is widely used in pharmaceutical and agrochemical research as a key intermediate for the synthesis of bioactive compounds, including fungicides, herbicides, and potential therapeutic agents. Its chlorinated positions enhance reactivity for substitution and coupling reactions, while the methyl groups provide stability and structural diversity. With consistent quality and excellent performance, 4,5-Dichloro-2,6-dimethylpyrimidine is an essential reagent for advancing research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 105742-66-3 |
Molecular Formula | C6H6Cl2N2 |
Purity | ≥95% |
IUPAC Name | 4,5-dichloro-2,6-dimethylpyrimidine |
InChI | InChI=1S/C6H6Cl2N2/c1-3-5(7)6(8)10-4(2)9-3/h1-2H3 |
InChIKey | GCOLCOMAZNJNON-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NC(=N1)C)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |