For research use only. Not for therapeutic Use.
4,5-Dichloro-3-methylthiophene-2-carboxylic Acid(CAT: L030285) is a high-quality heterocyclic compound essential for advanced pharmaceutical and chemical research. This chlorinated thiophene derivative serves as a versatile building block in the synthesis of complex organic molecules and bioactive compounds. Its unique structure supports research into medicinal chemistry, particularly in developing novel therapeutic agents and drug intermediates. With excellent stability and reactivity, it is suitable for diverse experimental setups, including functionalization studies and material science applications. 4,5-Dichloro-3-methylthiophene-2-carboxylic Acid offers exceptional reliability, making it a valuable asset in precision-driven research and innovation.
CAS Number | 854626-34-9 |
Molecular Formula | C6H4Cl2O2S |
Purity | ≥95% |
IUPAC Name | 4,5-dichloro-3-methylthiophene-2-carboxylic acid |
InChI | InChI=1S/C6H4Cl2O2S/c1-2-3(7)5(8)11-4(2)6(9)10/h1H3,(H,9,10) |
InChIKey | XZOTWSGVXFPSJX-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=C1Cl)Cl)C(=O)O |