For research use only. Not for therapeutic Use.
4,5-Diethylbenzene-1,2-dicarbonitrile (Cat.No:L004134) is a pivotal compound in organic synthesis. Its distinctive structure, featuring two cyano groups on a diethylbenzene backbone, imparts unique reactivity. This compound serves as a crucial intermediate in the preparation of specialized organic molecules with various applications in pharmaceutical and chemical research.
CAS Number | 96563-12-1 |
Molecular Formula | C12H12N2 |
Purity | ≥95% |
IUPAC Name | 4,5-diethylbenzene-1,2-dicarbonitrile |
InChI | InChI=1S/C12H12N2/c1-3-9-5-11(7-13)12(8-14)6-10(9)4-2/h5-6H,3-4H2,1-2H3 |
InChIKey | HTZTVMKBRKYSKD-UHFFFAOYSA-N |
SMILES | CCC1=CC(=C(C=C1CC)C#N)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |