For research use only. Not for therapeutic Use.
4,5-Diiodo-2-methyl-1H-imidazole(Cat No.:L023212)is a highly specialized chemical compound used in pharmaceutical and biochemical research. This iodinated imidazole derivative is valuable for the synthesis of complex organic molecules, particularly in the development of potential therapeutic agents targeting various diseases. Its unique structure, featuring two iodine atoms, makes it an important building block in creating compounds with enhanced biological activity. With its high purity and consistent quality, 4,5-Diiodo-2-methyl-1H-imidazole is essential for research applications requiring precise chemical transformations and reliable results in medicinal chemistry.
CAS Number | 73746-44-8 |
Molecular Formula | C4H4I2N2 |
Purity | ≥95% |
IUPAC Name | 4,5-diiodo-2-methyl-1H-imidazole |
InChI | InChI=1S/C4H4I2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
InChIKey | WFEZOLYJPCODOA-UHFFFAOYSA-N |
SMILES | CC1=NC(=C(N1)I)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |