For research use only. Not for therapeutic Use.
4,5-Dimethoxyisobenzofuran-1(3H)-one is a heterocyclic organic compound featuring an isobenzofuran structure with two methoxy groups at the 4 and 5 positions. This compound exhibits a fused bicyclic system, making it notable for its unique structural features. Its presence of the methoxy substituents enhances its solubility and potential biological activity. It may have applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its intriguing properties and reactivity in various chemical reactions.
CAS Number | 4741-58-6 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | 4,5-dimethoxy-3H-2-benzofuran-1-one |
InChI | InChI=1S/C10H10O4/c1-12-8-4-3-6-7(9(8)13-2)5-14-10(6)11/h3-4H,5H2,1-2H3 |
InChIKey | ZXIMTZPOPPEWHU-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C(C=C1)C(=O)OC2)OC |