For research use only. Not for therapeutic Use.
4,5-Dimethylbenzene-1,2-dimethanol(Cat No.:L007142), is a chemical compound with the molecular formula C10H14O2. It contains a benzene ring substituted with two methyl groups at the 4th and 5th positions, each connected to a methanol (-CH2OH) group. This compound is used in organic synthesis, often serving as a valuable intermediate in the preparation of various complex molecules. Its versatile reactivity makes it important in the creation of pharmaceuticals, agrochemicals, and specialty chemicals. Researchers employ 4,5-dimethylbenzene-1,2-dimethanol as a key building block, enabling the synthesis of diverse compounds and contributing to advancements in the field of chemical research and industrial applications.
CAS Number | 60070-05-5 |
Molecular Formula | C10H14O2 |
Purity | ≥95% |
IUPAC Name | [2-(hydroxymethyl)-4,5-dimethylphenyl]methanol |
InChI | InChI=1S/C10H14O2/c1-7-3-9(5-11)10(6-12)4-8(7)2/h3-4,11-12H,5-6H2,1-2H3 |
InChIKey | VSODREOTHFONSP-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C)CO)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |