For research use only. Not for therapeutic Use.
4,5-Dimethylcatechol is an organic compound featuring two methyl groups on a catechol structure. It is crucial for advanced research in synthetic organic chemistry and pharmaceutical development. Its unique structure and reactivity make it an essential intermediate for synthesizing biologically active molecules, facilitating progress in scientific investigations and technological advancements.
| Catalog Number | R022355 |
| CAS Number | 2785-74-2 |
| Synonyms | 4,5-Dimethyl-1,2-benzenediol; 4,5-Dimethylpyrocatechol; o-Xylene-4,5-diol |
| Molecular Formula | C8H10O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,5-dimethylbenzene-1,2-diol |
| InChI | InChI=1S/C8H10O2/c1-5-3-7(9)8(10)4-6(5)2/h3-4,9-10H,1-2H3 |
| InChIKey | VKQJFKLRXDLRNP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)O)O |
