For research use only. Not for therapeutic Use.
4,5-Dimethyloxazol-2-amine(Cat No.:L014465)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a dimethyl-substituted oxazole ring with an amine group at the 2-position, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for specific reactivity and diverse chemical transformations, facilitating the development of novel therapeutic agents. 4,5-Dimethyloxazol-2-amine is essential for precise synthetic applications in medicinal chemistry and innovative research endeavors.
Catalog Number | L014465 |
CAS Number | 45529-92-8 |
Molecular Formula | C5H8N2O |
Purity | ≥95% |
IUPAC Name | 4,5-dimethyl-1,3-oxazol-2-amine |
InChI | InChI=1S/C5H8N2O/c1-3-4(2)8-5(6)7-3/h1-2H3,(H2,6,7) |
InChIKey | VHZVSAXCIKCRAK-UHFFFAOYSA-N |
SMILES | CC1=C(OC(=N1)N)C |