For research use only. Not for therapeutic Use.
4,5-dimethylphthalic Acid(CAT: L000138) is a compound of significance in material chemistry and organic synthesis. Its action mechanism involves serving as a fundamental building block for the production of various organic compounds and polymers. In material chemistry, it plays a pivotal role in the development of specialized materials, particularly in the synthesis of high-performance polymers and resins.
CAS Number | 5680-10-4 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | 4,5-dimethylphthalic acid |
InChI | InChI=1S/C10H10O4/c1-5-3-7(9(11)12)8(10(13)14)4-6(5)2/h3-4H,1-2H3,(H,11,12)(H,13,14) |
InChIKey | FLLRBCSVUAPCKX-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |