For research use only. Not for therapeutic Use.
4,6-Dichloro-1H-imidazo[4,5-c]pyridin-2(3H)-one(Cat No.:L034177)is a heterocyclic compound used as a key intermediate in the synthesis of pharmaceuticals and bioactive molecules. Its structure, featuring chlorine atoms at the 4- and 6-positions of the imidazo[4,5-c]pyridine ring, along with a ketone group at the 2-position, makes it highly reactive and versatile for chemical modifications. This compound is particularly valuable in medicinal chemistry for the development of antiviral, anticancer, and anti-inflammatory agents. Its unique reactivity and structural properties make it essential in drug discovery and the synthesis of complex organic compounds.
CAS Number | 668268-68-6 |
Molecular Formula | C6H3Cl2N3O |
Purity | ≥95% |
IUPAC Name | 4,6-dichloro-1,3-dihydroimidazo[4,5-c]pyridin-2-one |
InChI | InChI=1S/C6H3Cl2N3O/c7-3-1-2-4(5(8)10-3)11-6(12)9-2/h1H,(H2,9,11,12) |
InChIKey | GOBSCYOMGGGJOG-UHFFFAOYSA-N |
SMILES | C1=C2C(=C(N=C1Cl)Cl)NC(=O)N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |