For research use only. Not for therapeutic Use.
4,6-Dichloro-3-methylbenzofuran(CAT: L000080) is a significant chemical compound with relevance in organic chemistry and material science. This compound features a benzofuran core substituted with chlorine atoms and a methyl group. It is commonly used as an important intermediate in the synthesis of organic molecules, particularly in the development of materials and specialty polymers.
| CAS Number | 81078-72-0 |
| Molecular Formula | C9H6Cl2O |
| Purity | ≥95% |
| IUPAC Name | 4,6-dichloro-3-methyl-1-benzofuran |
| InChI | InChI=1S/C9H6Cl2O/c1-5-4-12-8-3-6(10)2-7(11)9(5)8/h2-4H,1H3 |
| InChIKey | UIXOZFFMGRBBHR-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
