For research use only. Not for therapeutic Use.
4,6-Dichloro-5-ethylpyrimidin-2-amine(CAT: L019069) is a chlorinated pyrimidine derivative used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. This compound features chlorine atoms at the 4- and 6-positions and an ethyl group at the 5-position on the pyrimidine ring, with an amino group at the 2-position. The dichloro substitution pattern allows for selective functionalization, enabling further derivatization through nucleophilic substitution, making it valuable in building complex heterocyclic structures. In medicinal chemistry, this compound serves as a versatile scaffold for developing bioactive molecules, especially those targeting enzymatic or receptor pathways, where the pyrimidine core contributes to binding affinity and stability.
CAS Number | 6343-68-6 |
Molecular Formula | C6H7Cl2N3 |
Purity | ≥95% |
IUPAC Name | 4,6-dichloro-5-ethylpyrimidin-2-amine |
InChI | InChI=1S/C6H7Cl2N3/c1-2-3-4(7)10-6(9)11-5(3)8/h2H2,1H3,(H2,9,10,11) |
InChIKey | RFDSRYRJLQXWBR-UHFFFAOYSA-N |