For research use only. Not for therapeutic Use.
4,6-Dichloro-5-nitropyrimidine (Cat.No:R002913) is a chemical compound used as a building block in organic synthesis. Its versatile nature makes it valuable in creating various pharmaceuticals and agrochemicals. By serving as a key intermediate, 4,6-Dichloro-5-nitropyrimidine plays a crucial role in the development of diverse compounds for multiple applications.
| Catalog Number | R002913 |
| CAS Number | 4316-93-2 |
| Synonyms | NSC 89693; |
| Molecular Formula | C4HCl2N3O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,6-dichloro-5-nitropyrimidine |
| InChI | InChI=1S/C4HCl2N3O2/c5-3-2(9(10)11)4(6)8-1-7-3/h1H |
| InChIKey | HCTISZQLTGAYOX-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)[N+](=O)[O-])Cl |
