For research use only. Not for therapeutic Use.
4,6-Dichloro-5-(propan-2-yl)pyrimidine(Cat No.:L007310), is a chemical compound used in various industrial applications and organic synthesis. Its molecular structure consists of a pyrimidine ring with chlorine atoms at positions 4 and 6 and an isopropyl group attached to position 5. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its versatile reactivity allows chemists to create diverse molecular structures, making it valuable in medicinal chemistry research. Additionally, it is employed in the development of novel materials and compounds for different scientific and industrial purposes.
CAS Number | 89938-06-7 |
Molecular Formula | C7H8Cl2N2 |
Purity | ≥95% |
IUPAC Name | 4,6-dichloro-5-propan-2-ylpyrimidine |
InChI | InChI=1S/C7H8Cl2N2/c1-4(2)5-6(8)10-3-11-7(5)9/h3-4H,1-2H3 |
InChIKey | WGEQNVJAKYNYTM-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(N=CN=C1Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |