For research use only. Not for therapeutic Use.
4,6-Dichloroimidazo[4,5-c]pyridine is a heterocyclic compound containing both imidazole and pyridine rings, with chlorine atoms attached at the 4- and 6-positions. This compound is often used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and bioactive molecules. Its unique structure makes it valuable for creating molecules that can interact with biological targets, including enzymes and receptors. Researchers explore 4,6-Dichloroimidazo[4,5-c]pyridine for its potential in medicinal chemistry, including its use in synthesizing antiviral, anticancer, or antimicrobial agents due to its ability to participate in diverse chemical reactions.
CAS Number | 2589-12-0 |
Synonyms | 2,6-Dichloro-3-deazapurine; 4,6-Dichloroimidazo[4,5-c]pyridine; NSC 264047; |
Molecular Formula | C6H3Cl2N3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4,6-dichloro-1H-imidazo[4,5-c]pyridine |
InChI | InChI=1S/C6H3Cl2N3/c7-4-1-3-5(6(8)11-4)10-2-9-3/h1-2H,(H,9,10) |
InChIKey | FDXNZTUWNBRZDX-UHFFFAOYSA-N |
SMILES | C1=C2C(=C(N=C1Cl)Cl)N=CN2 |