For research use only. Not for therapeutic Use.
4,6-Dichloronicotinic acid (Cat.No:M349441) is a chemical compound known for its applications in organic synthesis. It serves as a valuable intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. This compound’s unique structure makes it useful in creating molecules with specific properties and functions.
CAS Number | 73027-79-9 |
Molecular Formula | C6H3Cl2NO2 |
Purity | ≥95% |
IUPAC Name | 4,6-dichloropyridine-3-carboxylic acid |
InChI | InChI=1S/C6H3Cl2NO2/c7-4-1-5(8)9-2-3(4)6(10)11/h1-2H,(H,10,11) |
InChIKey | ILMIEWNDXAKVNI-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1Cl)C(=O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |