For research use only. Not for therapeutic Use.
4,6-Dichloropicolinaldehyde is a chlorinated derivative of picolinaldehyde, featuring chlorine atoms at the 4th and 6th positions of the pyridine ring and an aldehyde group at the 2-position. This compound is of interest in organic synthesis and medicinal chemistry due to its reactive aldehyde group, which allows for further functionalization. It is commonly used as a building block in the preparation of complex molecules, including pharmaceuticals and agrochemicals, and is studied for its potential applications in drug development and material science.
CAS Number | 132683-62-6 |
Molecular Formula | C6H3Cl2NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,6-dichloropyridine-2-carbaldehyde |
InChI | InChI=1S/C6H3Cl2NO/c7-4-1-5(3-10)9-6(8)2-4/h1-3H |
InChIKey | VNSCIAVHRDIZMI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1C=O)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |