For research use only. Not for therapeutic Use.
4,6-Dimethoxy-phthalide(Cat No.:L007797), is a chemical compound with the molecular formula C10H10O4. It falls into the class of phthalides, a group of organic compounds commonly found in various natural products and essential oils. The “4,6-dimethoxy” prefix indicates the presence of methoxy groups (–OCH3) at the 4th and 6th positions on the phthalide ring structure. Phthalides exhibit diverse biological activities and are often studied for their potential pharmaceutical applications. Researchers might investigate this specific compound for its medicinal properties or as a building block in the synthesis of more complex molecules in organic chemistry laboratories.
CAS Number | 58545-97-4 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | 4,6-dimethoxy-3H-2-benzofuran-1-one |
InChI | InChI=1S/C10H10O4/c1-12-6-3-7-8(5-14-10(7)11)9(4-6)13-2/h3-4H,5H2,1-2H3 |
InChIKey | FJPMLTZXTKBVKX-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(COC2=O)C(=C1)OC |