For research use only. Not for therapeutic Use.
4,6-Dimethoxypyridin-3-amine(Cat No.:L028329)is an organic compound featuring methoxy groups at the 4 and 6 positions and an amino group at the 3-position on the pyridine ring. This compound is widely used in pharmaceutical and chemical research as a versatile intermediate for synthesizing bioactive molecules, including potential therapeutic agents. Its structure allows for various chemical modifications, making it valuable in the development of complex organic compounds, such as enzyme inhibitors and receptor modulators. 4,6-Dimethoxypyridin-3-amine is essential for researchers focused on innovative synthetic methodologies and advancing medicinal chemistry.
CAS Number | 89943-34-0 |
Molecular Formula | C7H10N2O2 |
Purity | ≥95% |
IUPAC Name | 4,6-dimethoxypyridin-3-amine |
InChI | InChI=1S/C7H10N2O2/c1-10-6-3-7(11-2)9-4-5(6)8/h3-4H,8H2,1-2H3 |
InChIKey | WYPPFWXTKDBNSZ-UHFFFAOYSA-N |
SMILES | COC1=CC(=NC=C1N)OC |