For research use only. Not for therapeutic Use.
4,7-Bis(chlorosulfophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid(Cat No.:M020466) is a chemically complex molecule featuring a phenanthroline core, which is a nitrogen-containing heterocyclic compound. This core is flanked by two carboxylic acid groups at the 2 and 9 positions, enhancing its acidity and solubility. Additionally, it has chlorosulfophenyl groups attached at the 4 and 7 positions, introducing sulfonic acid and chlorine functionalities. These groups increase their reactivity and potential for further chemical modifications. This compound’s intricate structure and functional groups make it particularly useful in coordination chemistry for binding metal ions, potentially for applications in catalysis or materials science.
CAS Number | 112076-76-3 |
Synonyms | 4,7-bis(chlorosulfophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid |
Molecular Formula | C26H14Cl2N2O10S2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4,7-bis(3-chloro-2-sulfophenyl)-1,10-phenanthroline-2,9-dicarboxylic acid |
InChI | InChI=1S/C26H14Cl2N2O10S2/c27-17-5-1-3-13(23(17)41(35,36)37)15-9-19(25(31)32)29-21-11(15)7-8-12-16(10-20(26(33)34)30-22(12)21)14-4-2-6-18(28)24(14)42(38,39)40/h1-10H,(H,31,32)(H,33,34)(H,35,36,37)(H,38,39,40) |
InChIKey | VEJHUGGPLQWGPR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)O)C2=CC(=NC3=C2C=CC4=C3N=C(C=C4C5=C(C(=CC=C5)Cl)S(=O)(=O)O)C(=O)O)C(=O)O |