For research use only. Not for therapeutic Use.
4,7-Dibromo-1H-indazole(CAT; L025650) is a high-purity halogenated heterocyclic compound featuring two bromine atoms at the 4- and 7-positions of the indazole core. This versatile molecule serves as a valuable building block in pharmaceutical and chemical research, particularly for synthesizing bioactive compounds, including kinase inhibitors and other therapeutic agents. Its brominated structure allows for further functionalization through cross-coupling reactions, such as Suzuki or Buchwald-Hartwig couplings, facilitating the creation of complex heterocyclic frameworks. 4,7-Dibromo-1H-indazole is an essential intermediate for medicinal chemistry and material science, offering excellent stability and reactivity for innovative synthetic applications.
CAS Number | 1316273-52-5 |
Molecular Formula | C7H4Br2N2 |
Purity | ≥95% |
IUPAC Name | 4,7-dibromo-1H-indazole |
InChI | InChI=1S/C7H4Br2N2/c8-5-1-2-6(9)7-4(5)3-10-11-7/h1-3H,(H,10,11) |
InChIKey | MUHVCDFIOFMKQV-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1Br)C=NN2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |